CAS 5368-42-3

1,8-dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid

Description:

1,8-Dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid, with CAS number 5368-42-3, is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both a pyridine and a pyrazine moiety. This compound features two carbonyl groups (dioxo) and a carboxylic acid functional group, which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that it may participate in various chemical reactions, such as nucleophilic attacks or hydrogen bonding. The compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can influence its solubility in polar solvents. Additionally, its structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1,8-dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid represents a unique class of compounds with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₈N₂O₄

InChI: InChI=1/C9H8N2O4/c12-5-3-6-8(13)10-1-2-11(6)7(4-5)9(14)15/h3-4H,1-2H2,(H,10,13)(H,14,15)

SMILES: C1Cn2c(cc(=O)cc2C(=O)O)C(=O)N1

Synonyms:

• 2H-pyrido[1,2-a]pyrazine-6-carboxylic acid, 1,3,4,8-tetrahydro-1,8-dioxo-
• 1,8-Dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid

1,8-Dioxo-1,3,4,8-tetrahydro-2H-pyrido[1,2-a]pyrazine-6-carboxylic acid

CAS: 5368-42-3

Versatile small molecule scaffold

Formula: C₉H₈N₂O₄

Purity: Min. 95%

Molecular weight: 208.17 g/mol

Ref: 3D-FAA36842