CAS 53684-90-5
:benzyl (3S,4S,5S,6R)-3,4,5-tribenzyloxy-6-hydroxy-tetrahydropyran-2-carboxylate
Description:
Benzyl (3S,4S,5S,6R)-3,4,5-tribenzyloxy-6-hydroxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. The presence of multiple benzyloxy groups indicates that it has significant aromatic character, contributing to its stability and potential reactivity. The stereochemistry of the molecule, denoted by the (3S,4S,5S,6R) configuration, suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions with other molecules. The hydroxy group at position 6 adds to its polarity, potentially enhancing solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its CAS number, 53684-90-5, allows for easy identification in chemical databases, facilitating access to its synthesis, properties, and applications in various fields, including organic synthesis and drug development.
Formula:C34H34O7
InChI:InChI=1/C34H34O7/c35-33(40-24-28-19-11-4-12-20-28)32-30(38-22-26-15-7-2-8-16-26)29(37-21-25-13-5-1-6-14-25)31(34(36)41-32)39-23-27-17-9-3-10-18-27/h1-20,29-32,34,36H,21-24H2/t29-,30-,31-,32?,34+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3,4-Tri-O-benzyl-D-glucuronide benzyl ester
CAS:<p>2,3,4-Tri-O-benzyl-D-glucuronide benzyl ester is a synthetic glycosylation product. It has been custom synthesized and modified with fluorination and methylation. This compound is an oligosaccharide that can be used as a pharmaceutical intermediate or in the synthesis of complex carbohydrates. 2,3,4-Tri-O-benzyl-D-glucuronide benzyl ester has been shown to have high purity and can be used for research purposes.</p>Formula:C34H34O7Purity:Min. 95%Color and Shape:PowderMolecular weight:554.63 g/molBenzyl 2,3,4-Tri-O-benzyl-D-glucuronate
CAS:Controlled Product<p>Applications Benzyl 2,3,4-Tri-O-benzyl-D-glucuronate (cas# 53684-90-5) is a compound useful in organic synthesis.<br></p>Formula:C34H34O7Color and Shape:NeatMolecular weight:554.63


