CAS 53694-87-4
:1-azido-4-iodobenzene
Description:
1-Azido-4-iodobenzene is an organic compound characterized by the presence of both an azide group (-N3) and an iodine atom attached to a benzene ring. This compound features a phenyl group where the azido group is substituted at the para position relative to the iodine atom. It is typically a yellow to orange solid that is sensitive to heat and shock, making it potentially hazardous. The azide functional group is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. The iodine atom contributes to the compound's electrophilic character, enhancing its reactivity in nucleophilic substitution reactions. 1-Azido-4-iodobenzene is utilized in organic synthesis, particularly in the development of pharmaceuticals and materials science. Due to its functional groups, it can participate in a variety of chemical reactions, including coupling reactions and the formation of more complex structures. Proper handling and storage are essential due to its sensitivity and potential explosive nature under certain conditions.
Formula:C6H4IN3
InChI:InChI=1/C6H4IN3/c7-5-1-3-6(4-2-5)9-10-8/h1-4H
SMILES:c1cc(ccc1I)N=[N+]=[NH-]
Synonyms:- 1-Iodo-4-azidobenzene
- 4-Iodophenyl azide
- Benzene, 1-Azido-4-Iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
