CAS 53696-59-6
:8-azidoadenosine 5'-triphosphate sodium
Description:
8-Azidoadenosine 5'-triphosphate sodium (CAS 53696-59-6) is a nucleotide analog that serves as a useful tool in biochemical research, particularly in studies involving nucleic acid interactions and enzyme mechanisms. This compound features an azido group at the 8-position of the adenine base, which allows for specific labeling and cross-linking applications due to the azido group's reactivity. As a triphosphate, it contains three phosphate groups, which are crucial for its role in energy transfer and as a substrate for various enzymatic reactions. The sodium salt form enhances its solubility in aqueous solutions, making it suitable for in vitro experiments. 8-Azidoadenosine 5'-triphosphate can be utilized in photochemical studies, as the azido group can be activated by UV light, leading to the formation of reactive species that can interact with biomolecules. Overall, this compound is valuable in molecular biology and biochemistry for probing the dynamics of nucleic acids and proteins.
Formula:C10H15N8O13P3
InChI:InChI=1/C10H15N8O13P3/c11-7-4-8(14-2-13-7)18(10(15-4)16-17-12)9-6(20)5(19)3(29-9)1-28-33(24,25)31-34(26,27)30-32(21,22)23/h2-3,5-6,9,19-20H,1H2,(H,24,25)(H,26,27)(H2,11,13,14)(H2,21,22,23)/t3-,5-,6-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2c3c(c(N)ncn3)nc2N=[N+]=[NH-])O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O
Synonyms:- 8-Azidoadenosine 5'-triphosphate
- 8-Azido-ATP
- Adenosine 5'-(tetrahydrogen triphosphate), 8-azido-
- 8-Azidoadenosine 5'-(Tetrahydrogen Triphosphate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Azido-ATP
CAS:8-Azido-ATP is a nucleotide analog that demonstrates photo-reactivity properties.Formula:C10H15N8O13P3Color and Shape:SolidMolecular weight:548.198-azido-ATP sodium salt - 10mM aqueous solution
CAS:<p>8-Azidoadenosine 3',5'-cyclic monophosphosphate is used for nucleotide labelling via a click reaction involving the azide moiety and a terminal alkyne conjugated to a label. The reaction generates a stable nucleotide labelled adduct containing a triazole link.</p>Formula:C10H12N8O13P3·Na3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:614.14 g/mol8-Azidoadenosine-5'-triphosphate, sodium salt
CAS:<p>8-Azidoadenosine-5'-triphosphate, sodium salt</p>Purity:≥95%Molecular weight:571.18g/mol



