CAS 53696-70-1

(2S)-2-amino-4-(4-aminocyclohexa-2,5-dien-1-yl)butanoic acid

Description:

(2S)-2-amino-4-(4-aminocyclohexa-2,5-dien-1-yl)butanoic acid, also known by its CAS number 53696-70-1, is an amino acid derivative characterized by its unique structure that includes a cyclohexadiene moiety. This compound features a chiral center at the second carbon, contributing to its stereochemistry. It possesses both amino and carboxylic acid functional groups, which are typical of amino acids, allowing it to participate in various biochemical reactions. The presence of the cyclohexadiene ring introduces aromatic characteristics, potentially influencing its reactivity and interactions in biological systems. This compound may exhibit properties such as solubility in polar solvents, and its biological activity could be linked to its structural features, making it of interest in medicinal chemistry and biochemistry. Its specific applications and behavior in biological systems would depend on further studies, including its interactions with enzymes and receptors. Overall, this compound represents a fascinating intersection of amino acid chemistry and cyclic organic structures.

Formula: C₁₀H₁₆N₂O₂

InChI: InChI=1/C10H16N2O2/c11-8-4-1-7(2-5-8)3-6-9(12)10(13)14/h1-2,4-5,7-9H,3,6,11-12H2,(H,13,14)/t7?,8?,9-/m0/s1

Amiclenomycin

CAS: 53696-70-1

Amiclenomycin is an antibiotic. It has activity against mycobacterium.

Formula: C₁₀H₁₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.25

Ref: TM-T23724