CAS 53696-74-5
:Armillarisin A
Description:
Armillarisin A is a naturally occurring compound classified as a sesquiterpene, primarily derived from certain fungi, particularly those in the Armillaria genus. It is known for its potential pharmacological properties, including anti-inflammatory and anticancer activities. The molecular structure of Armillarisin A features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its biological activity. This compound has garnered interest in medicinal chemistry due to its ability to modulate various biological pathways. Additionally, Armillarisin A exhibits low toxicity, making it a candidate for further research in therapeutic applications. Its solubility characteristics can vary, often being more soluble in organic solvents than in water, which is typical for many sesquiterpenes. As research continues, the full spectrum of its biological effects and potential applications in medicine and agriculture is being explored, highlighting the importance of natural products in drug discovery and development.
Formula:C12H10O5
InChI:InChI=1/C12H10O5/c1-6(14)9-4-10-7(5-13)2-8(15)3-11(10)17-12(9)16/h2-4,13,15H,5H2,1H3
InChI key:InChIKey=XVZWWNMZVZWQKU-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(OC(=O)C(C(C)=O)=C2)=CC(O)=C1
Synonyms:- 2H-1-Benzopyran-2-one, 3-acetyl-7-hydroxy-5-(hydroxymethyl)-
- 3-Acetyl-5-hydroxymethyl-7-hydroxycoumarin
- 3-Acetyl-7-hydroxy-5-(hydroxymethyl)-2H-1-benzopyran-2-one
- 3-Acetyl-7-hydroxy-5-(hydroxymethyl)chromen-2-one
- 3-acetyl-7-hydroxy-5-(hydroxymethyl)-2H-chromen-2-one
- Armillarisin A
- 3-acetyl-7-hydroxy-5-(hydroxymethyl)-2h-1-benzopyran-2-on
- Armillarisin
- Armillarisinum
- 3-ACETYL-5-HYDROXYLMETHYL-7-HYDROXYCOUMARIN
- 3-acetyl-5-hydroxylmetyl-7-hydroxycoumarin
- larisin A
- amillaria mellea powder
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-1-Benzopyran-2-one, 3-acetyl-7-hydroxy-5-(hydroxymethyl)-
CAS:Formula:C12H10O5Purity:98%Color and Shape:SolidMolecular weight:234.2048Armillarisin A
CAS:Armillarisin A enhancing the role of macrophages, inhibiting bacteria growth, improving the protein metabolism, and regulating liver function.Formula:C12H10O5Purity:99.67% - 99.85%Color and Shape:SolidMolecular weight:234.23-Acetyl-5-hydroxymethyl-7-hydroxycoumarin
CAS:3-Acetyl-5-hydroxymethyl-7-hydroxycoumarin is a synthetic coumarin derivative, which is a class of organic compounds often found in natural products. These compounds are derived from plant sources and are known for their significant biochemical effects and aromatic properties. The mode of action of 3-Acetyl-5-hydroxymethyl-7-hydroxycoumarin involves interactions at the molecular level, where it can exhibit various biological activities, such as antioxidant and antimicrobial effects. Due to the hydroxyl and acetyl functional groups present, it can participate in redox reactions and binding interactions, affecting biochemical pathways.Formula:C12H10O5Purity:Min. 95%Color and Shape:Light (Or Pale) Yellow To Orange Yellow SolidMolecular weight:234.2 g/mol




