CAS 537-33-7: Sinapyl alcohol
Description:Sinapyl alcohol, with the CAS number 537-33-7, is an organic compound classified as a phenolic alcohol. It is characterized by its structure, which includes a phenolic ring and a long-chain aliphatic side group. This compound is typically found in various plants, particularly in the family Brassicaceae, and plays a role in the biosynthesis of lignin, a key structural component in plant cell walls. Sinapyl alcohol is known for its antioxidant properties and potential applications in the food and cosmetic industries due to its ability to scavenge free radicals. Additionally, it serves as a precursor for the synthesis of other important compounds, including sinapate esters, which are involved in plant defense mechanisms. Sinapyl alcohol is generally soluble in organic solvents and exhibits low solubility in water. Its chemical behavior is influenced by the presence of hydroxyl groups, making it reactive in various chemical reactions, including etherification and esterification. Overall, sinapyl alcohol is a significant compound in both natural and synthetic chemistry contexts.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-4,6-7,12-13H,5H2,1-2H3
InChI key:InChIKey=LZFOPEXOUVTGJS-UHFFFAOYSA-N
SMILES:OC=1C(OC)=CC(C=CCO)=CC1OC
- Synonyms:
- 2-Propen-1-ol, 3-(4-hydroxy-3,5-dimethoxyphenyl)-
- 3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-propen-1-ol
- 4-(3-Hydroxy-1-propen-1-yl)-2,6-dimethoxyphenol
- 4-(3-Hydroxyprop-1-En-1-Yl)-2,6-Dimethoxyphenol
- 4-[(1E)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenol
- Phenol, 4-(3-hydroxy-1-propen-1-yl)-2,6-dimethoxy-
- Phenol, 4-(3-hydroxy-1-propenyl)-2,6-dimethoxy-
- Sinapic alcohol
- p-Hydroxy-m,m′-dimethoxycinnamyl alcohol
- Sinapyl alcohol
- See more synonyms
