CAS 537-45-1
:2,6-Dibromoquinone-4-chloroimide
Description:
2,6-Dibromoquinone-4-chloroimide, with the CAS number 537-45-1, is a synthetic organic compound that belongs to the class of quinones and imides. It is characterized by the presence of two bromine atoms and a chlorine atom attached to a quinone structure, which contributes to its reactivity and potential applications in various chemical processes. This compound typically exhibits a yellow to orange color, indicative of its conjugated system, which can absorb visible light. It is known for its electrophilic properties, making it useful in organic synthesis, particularly in the formation of more complex molecules. Additionally, 2,6-Dibromoquinone-4-chloroimide can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its stability and solubility can vary depending on the solvent used, and it is important to handle this compound with care due to its potential toxicity and environmental impact. Overall, its unique structure and reactivity make it a valuable compound in the field of organic chemistry.
Formula:C6H2Br2ClNO
InChI:InChI=1S/C6H2Br2ClNO/c7-4-1-3(10-9)2-5(8)6(4)11/h1-2H
InChI key:InChIKey=JYWKEVKEKOTYEX-UHFFFAOYSA-N
SMILES:N(Cl)=C1C=C(Br)C(=O)C(Br)=C1
Synonyms:- 2,5-Cyclohexadien-1-one, 2,6-dibromo-4-(chloroimino)-
- 2,6-Dibromo-1,4-benzoquinone-4-chlorimide
- 2,6-Dibromo-4-(chloroimino)-2,5-cyclohexadien-1-one
- 2,6-Dibromo-N-chloro-p-benzoquinoneimine
- 2,6-Dibromoquinone chlorimide
- 2,6-Dibromoquinone chloroimide
- 2,6-Dibromoquinone chloroimine
- 2,6-Dibromoquinone-4-chlorimide
- 2,6-Dibromoquinone-4-chloroimide
- 2,6-Dibromoquinone-4-chloroimine
- 4-(Chloroimino)-2,6-dibromo-2,5-cyclohexadien-1-one
- BQC reagent
- N-Chloro-2,6-dibromoquinoneimine
- Nsc 528
- p-Benzoquinone imine, 2,6-dibromo-N-chloro-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,6-Dibromoquinone-4-chloroimide
CAS:Formula:C6H2Br2ClNOPurity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:299.352,6-Dibromo-4-(chloroimino)cyclohexa-2,5-dienone
CAS:Formula:C6H2Br2ClNOPurity:98%Color and Shape:SolidMolecular weight:299.34722,6-Dibromoquinone-4-chloroimide
CAS:2,6-Dibromoquinone-4-chloroimide: a dye detecting phenolics, creates indigo at pH 9.4, measures aflatoxins turning them green at 673 nm.Formula:C6H2Br2ClNOColor and Shape:Off-White SolidMolecular weight:299.352,6-Dibromoquinone-4-chloroimide
CAS:Formula:C6H2Br2ClNOColor and Shape:Yellow SolidMolecular weight:299.352,6-Dibromoquinone-4-chloroimide
CAS:Formula:C6H2Br2ClNOPurity:≥ 97.0%Color and Shape:Yellow, orange or brown powderMolecular weight:299.352,6-Dibromoquinone-4-chloroimide
CAS:Formula:C6H2Br2ClNOColor and Shape:YellowMolecular weight:299.352,6-Dibromo-4-(chloroimino)cyclohexa-2,5-dienone
CAS:Formula:C6H2Br2ClNOPurity:95.0%Color and Shape:Solid, Yellow to reddish yellow powderMolecular weight:299.352,6-Dibromoquinone-4-chloroimide
CAS:<p>2,6-Dibromoquinone-4-chloroimide (DBQC) is a chemical compound that belongs to the class of hydroxyl compounds. It has been shown to be a potent inhibitor of phosphatases, which are enzymes that dephosphorylate phosphorylated proteins. DBQC inhibits the activity of lysine residues in serotonin reuptake inhibitors. This inhibition leads to an increase in serotonin levels and may have antidepressant effects.</p>Formula:C6H2Br2ClNOPurity:Min. 95%Molecular weight:299.35 g/mol







