CAS 537010-38-1

1-(2-chlorobenzyl)-1H-benzimidazole-2-carbaldehyde

Description:

1-(2-Chlorobenzyl)-1H-benzimidazole-2-carbaldehyde is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a chlorobenzyl group and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde group. The chlorine atom in the chlorobenzyl moiety can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. The presence of the benzimidazole ring suggests potential applications in pharmaceuticals, as benzimidazole derivatives are known for their diverse biological activities, including antifungal and anti-parasitic properties. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Overall, 1-(2-chlorobenzyl)-1H-benzimidazole-2-carbaldehyde is of interest in medicinal chemistry and may serve as a lead compound for further development in drug discovery.

Formula: C₁₅H₁₁ClN₂O

InChI: InChI=1/C15H11ClN2O/c16-12-6-2-1-5-11(12)9-18-14-8-4-3-7-13(14)17-15(18)10-19/h1-8,10H,9H2

SMILES: c1ccc(c(c1)Cn1c2ccccc2nc1C=O)Cl

Synonyms:

• 1-(2-Chloro-benzyl)-1H-benzoimidazole-2-carbaldehyde
• 1H-benzimidazole-2-carboxaldehyde, 1-[(2-chlorophenyl)methyl]-
• 1-(2-Chlorobenzyl)-1H-benzimidazole-2-carbaldehyde

1-(2-chlorobenzyl)-1H-benzimidazole-2-carbaldehyde

CAS: 537010-38-1

Formula: C₁₅H₁₁ClN₂O

Purity: 95.0%

Molecular weight: 270.72

Ref: 10-F315436