CAS 537033-54-8

4-Bromo-2,6-difluorophenylaceticacid

Description:

4-Bromo-2,6-difluorophenylacetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with bromine and fluorine atoms. The presence of these halogens influences the compound's reactivity and physical properties, such as solubility and boiling point. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for hydrogen bonding. The specific arrangement of the bromine and fluorine substituents on the phenyl ring can affect the compound's electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple halogens can enhance the compound's lipophilicity, impacting its biological activity and interaction with other molecules. As with many halogenated compounds, safety considerations are important due to potential toxicity and environmental impact. Overall, 4-Bromo-2,6-difluorophenylacetic acid is a compound of interest in synthetic chemistry and medicinal research due to its unique structural features and potential applications.

Formula: C₈H₅BrF₂O₂

InChI: InChI=1S/C8H5BrF2O2/c9-4-1-6(10)5(3-8(12)13)7(11)2-4/h1-2H,3H2,(H,12,13)

SMILES: c1c(cc(c(CC(=O)O)c1F)F)Br

Synonyms:

• 4-Bromo-2,6-Difluorophenylacetic Acid

4-Bromo-2,6-difluorophenylacetic acid, 96%, Thermo Scientific™

CAS: 537033-54-8

This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.

Formula: C₈H₅BrF₂O₂

Purity: 96%

Molecular weight: 251.02

Ref: 02-H66231

4-Bromo-2,6-difluorophenylacetic acid

CAS: 537033-54-8

Formula: C₈H₅BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 251.0249

Ref: IN-DA0033X7

4-Bromo-2,6-difluorophenylacetic acid

CAS: 537033-54-8

4-Bromo-2,6-difluorophenylacetic acid

Formula: C₈H₅BrF₂O₂

Purity: 97%

Color and Shape: white powder

Molecular weight: 251.02g/mol

Ref: 54-PC8245

4-Bromo-2,6-difluorophenylacetic acid

CAS: 537033-54-8

Formula: C₈H₅BrF₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 251.027

Ref: 10-F212025