CAS 537034-15-4

N-(2-aminophenyl)-N'-phenylheptanediamide

Description:

N-(2-aminophenyl)-N'-phenylheptanediamide, identified by its CAS number 537034-15-4, is a chemical compound characterized by its amide functional groups and aromatic amine structure. This compound features a heptanediamide backbone, which consists of a seven-carbon chain with two amine groups attached to phenyl rings. The presence of the amino groups contributes to its potential as a ligand in coordination chemistry and may influence its solubility and reactivity. The aromatic rings can provide stability and contribute to the compound's electronic properties, making it of interest in various applications, including pharmaceuticals and materials science. Additionally, the compound's structure suggests potential for hydrogen bonding and interactions with biological systems, which could be relevant for its biological activity or toxicity. Overall, N-(2-aminophenyl)-N'-phenylheptanediamide is a complex organic molecule with unique characteristics stemming from its functional groups and molecular architecture.

Formula: C₁₉H₂₃N₃O₂

InChI: InChI=1/C19H23N3O2/c20-16-11-7-8-12-17(16)22-19(24)14-6-2-5-13-18(23)21-15-9-3-1-4-10-15/h1,3-4,7-12H,2,5-6,13-14,20H2,(H,21,23)(H,22,24)

SMILES: c1ccc(cc1)N=C(CCCCCC(=Nc1ccccc1N)O)O

Synonyms:

• heptanediamide, N1
• N-(2-Aminophenyl)-N'-phenylheptanediamide

N-(2-Aminophenyl)-N'-phenylheptanediamide

CAS: 537034-15-4

Formula: C₁₉H₂₃N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 325.4048

Ref: IN-DA00DBAZ

NKL 22

CAS: 537034-15-4

NKL 22

Purity: ≥95%

Molecular weight: 325.4g/mol

Ref: 54-BUP13689

N1-(2-Aminophenyl)-N7-Phenylheptanediamide

CAS: 537034-15-4

N1-(2-Aminophenyl)-N7-Phenylheptanediamide

Purity: 98%

Molecular weight: 325.4g/mol

Ref: 54-OR1025640

NKL 22

CAS: 537034-15-4

NKL 22 (Histone Deacetylase Inhibitor IV) is an effective Histone Deacetylase Inhibitor.

Formula: C₁₉H₂₃N₃O₂

Purity: 96.16% - 96.24%

Color and Shape: Solid

Molecular weight: 325.4

Ref: TM-T3206

N-(2-Aminophenyl)-N’-phenylheptanediamide

Controlled Product

CAS: 537034-15-4

Formula: C₁₉H₂₃N₃O₂

Color and Shape: Neat

Molecular weight: 325.40

Ref: TR-A625980