CymitQuimica logo

CAS 537050-13-8

:

2-Bromo-1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone

Description:
2-Bromo-1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a trifluoromethyl group attached to a phenyl ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple halogens (bromine and fluorine) enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and altering the compound's biological activity. This compound may be utilized in pharmaceutical research, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental data or computational chemistry methods.
Formula:C9H5BrF4O
InChI:InChI=1S/C9H5BrF4O/c10-4-8(15)6-2-1-5(11)3-7(6)9(12,13)14/h1-3H,4H2
InChI key:InChIKey=UODSLDBFTFFTRT-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=C(C(F)(F)F)C=C(F)C=C1
Synonyms:
  • 2-Bromo-1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone
  • 2-Bromo-4′-fluoro-2′-trifluoromethylacetophenone
  • Ethanone, 2-bromo-1-[4-fluoro-2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.