CAS 53712-75-7
:4-Cyclopropyl-4-oxobutyric acid
Description:
4-Cyclopropyl-4-oxobutyric acid is an organic compound characterized by its cyclopropyl group and a ketone functional group adjacent to a carboxylic acid. This compound features a four-carbon backbone with a cyclopropyl substituent at one end, contributing to its unique structural properties. The presence of the ketone and carboxylic acid functional groups suggests that it may exhibit acidic behavior and participate in various chemical reactions, such as esterification or condensation. Its molecular structure allows for potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The compound's physical properties, such as solubility, boiling point, and melting point, would depend on its molecular interactions and the presence of functional groups. Additionally, the cyclopropyl moiety may influence the compound's reactivity and stability, making it an interesting subject for further research in chemical and biological contexts. As with any chemical substance, safety and handling precautions should be observed, given the potential hazards associated with organic acids and their derivatives.
Formula:C7H10O3
InChI:InChI=1/C7H10O3/c8-6(5-1-2-5)3-4-7(9)10/h5H,1-4H2,(H,9,10)
SMILES:C1CC1C(=O)CCC(=O)O
Synonyms:- 4-Cyclopropyl-4-Oxobutanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cyclopropyl-4-oxobutyric acid
CAS:Formula:C7H10O3Purity:97%Color and Shape:LiquidMolecular weight:142.15254-Cyclopropyl-4-Oxobutanoic Acid
CAS:4-Cyclopropyl-4-Oxobutanoic AcidPurity:≥97%Molecular weight:142.15g/mol4-Cyclopropyl-4-oxobutyric acid
CAS:4-Cyclopropyl-4-oxobutyric acid is a methanolic glutamic alkylation lactone that has been shown to be an asymmetric sodium salt. The nitriles of 4-cyclopropyl-4-oxobutyric acid are hydrolyzed to form the corresponding acids, which are then debenzylated to form the corresponding alcohols. This process is catalyzed by nitrile hydratase and oxidized by alcohol dehydrogenase. The bicyclic structure of 4-cyclopropyl-4-oxobutyric acid can be formed by condensation of two molecules of acetaldehyde and one molecule of malonic acid.Formula:C7H10O3Purity:Min. 95%Molecular weight:142.15 g/mol



