CymitQuimica logo

CAS 53715-88-1

:

2-Benzofurancarboxylic acid, 5-methyl-, ethyl ester

Description:
2-Benzofurancarboxylic acid, 5-methyl-, ethyl ester, also known by its CAS number 53715-88-1, is an organic compound characterized by its structure, which includes a benzofuran moiety and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of the carboxylic acid and ester functional groups suggests that it may participate in various chemical reactions, such as esterification and hydrolysis. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its melting point, boiling point, and other physical properties can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-3-14-12(13)11-7-9-6-8(2)4-5-10(9)15-11/h4-7H,3H2,1-2H3
InChI key:OERUTNQXHJZCDZ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(O1)C=CC(=C2)C
Found 4 products.