
CAS 53716-43-1
:(11β)-11,17-Dihydroxy-21-[[2-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]acetyl]oxy]pregn-4-ene-3,20-dione
Description:
The chemical substance known as (11β)-11,17-Dihydroxy-21-[[2-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]acetyl]oxy]pregn-4-ene-3,20-dione, with the CAS number 53716-43-1, is a synthetic steroid derivative. It features a complex structure characterized by multiple hydroxyl groups, which contribute to its potential biological activity. The presence of the indazole moiety suggests that it may interact with various biological targets, possibly influencing hormonal pathways or exhibiting anti-inflammatory properties. This compound is likely to exhibit lipophilicity due to its steroid backbone, which may affect its absorption and distribution in biological systems. Additionally, the presence of functional groups such as acetoxy and hydroxyl can enhance its reactivity and solubility in organic solvents. Overall, this compound's unique structural features may render it of interest in pharmaceutical research, particularly in the development of therapeutic agents targeting hormonal or inflammatory conditions. However, specific pharmacological properties and biological activities would require further investigation through empirical studies.
Formula:C37H42N2O7
InChI:InChI=1S/C37H42N2O7/c1-35-16-14-25(40)18-24(35)12-13-26-28-15-17-37(44,36(28,2)19-30(41)33(26)35)31(42)21-45-32(43)22-46-34-27-10-6-7-11-29(27)39(38-34)20-23-8-4-3-5-9-23/h3-11,18,26,28,30,33,41,44H,12-17,19-22H2,1-2H3/t26-,28-,30-,33+,35-,36-,37-/m0/s1
InChI key:InChIKey=DYVIEGCPUPGXOH-HGGPGNIHSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(CC3)=CC(=O)CC4)([C@@H](O)C1)[H])[H])(CC[C@@]2(C(COC(COC=5C=6C(N(CC7=CC=CC=C7)N5)=CC=CC6)=O)=O)O)[H]
Synonyms:- Pregn-4-ene-3,20-dione, 11,17-dihydroxy-21-[[2-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]acetyl]oxy]-, (11β)-
- Bendacort
- AF 2071
- (11β)-11,17-Dihydroxy-21-[[2-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]acetyl]oxy]pregn-4-ene-3,20-dione
- Pregn-4-ene-3,20-dione, 11,17-dihydroxy-21-[[[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]acetyl]oxy]-, (11β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bendacort
CAS:Bendacort is a biochemical.Formula:C37H42N2O7Color and Shape:SolidMolecular weight:626.74
