CAS 5372-40-7

[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol

Description:

[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol, with the CAS number 5372-40-7, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 4-chlorophenyl group indicates that there is a chlorinated aromatic substituent attached to the oxadiazole, which can influence the compound's reactivity and biological activity. The methanol functional group suggests that the compound has hydroxyl (-OH) functionality, which can enhance its solubility in polar solvents and may also play a role in hydrogen bonding interactions. This compound may exhibit various properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in pharmaceutical research. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1/C9H7ClN2O2/c10-7-3-1-6(2-4-7)9-11-8(5-13)14-12-9/h1-4,13H,5H2

SMILES: c1cc(ccc1c1nc(CO)on1)Cl

[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol

CAS: 5372-40-7

Formula: C₉H₇ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.6171

Ref: IN-DA00DCNB

[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol

CAS: 5372-40-7

[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol

Formula: C₉H₇ClN₂O₂

Purity: ≥95%

Color and Shape: solid

Molecular weight: 210.62g/mol

Ref: 54-OR15434