CAS 53726-70-8
:1-(2,3-dichloropropyl)-2-methyl-5-nitro-1H-imidazole
Description:
1-(2,3-Dichloropropyl)-2-methyl-5-nitro-1H-imidazole, with the CAS number 53726-70-8, is a chemical compound that belongs to the imidazole class of heterocyclic compounds. This substance features a five-membered ring containing two nitrogen atoms, which contributes to its basicity and potential reactivity. The presence of a nitro group (-NO2) at the 5-position enhances its electrophilic character, making it useful in various chemical reactions. The dichloropropyl substituent introduces significant hydrophobic characteristics, which can influence its solubility and interaction with biological systems. Additionally, the methyl group at the 2-position can affect the compound's steric properties and overall stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or antiparasitic agents. However, its specific applications and safety profile would require further investigation, including toxicity studies and environmental impact assessments.
Formula:C7H9Cl2N3O2
InChI:InChI=1/C7H9Cl2N3O2/c1-5-10-3-7(12(13)14)11(5)4-6(9)2-8/h3,6H,2,4H2,1H3
Synonyms:- 1H-imidazole, 1-(2,3-dichloropropyl)-2-methyl-5-nitro-
- 1-(2,3-Dichloropropyl)-2-methyl-5-nitro-1H-imidazole
- Disodium phosphate levononidazole ester impurity 9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
