
CAS 5373-42-2
:(+)-Thalicarpine
Description:
(+)-Thalicarpine is an alkaloid derived from the plant Thalictrum species, particularly known for its presence in Thalictrum fimbriatum. It is characterized by its complex bicyclic structure, which includes a fused isoquinoline framework. This compound exhibits a range of biological activities, including potential analgesic and anti-inflammatory properties, making it of interest in pharmacological research. (+)-Thalicarpine is typically found as a white to off-white crystalline solid, and its solubility varies depending on the solvent, often being more soluble in organic solvents than in water. The compound's stereochemistry is significant, as the (+) designation indicates its specific optical activity, which can influence its biological interactions. Additionally, (+)-Thalicarpine has been studied for its effects on various biological systems, including its potential role in modulating neurotransmitter systems. As with many alkaloids, safety and toxicity profiles are important considerations in its use and study.
Formula:C41H48N2O8
InChI:InChI=1S/C41H48N2O8/c1-42-12-10-23-16-32(44-3)34(46-5)20-27(23)29(42)15-26-19-33(45-4)36(48-7)22-31(26)51-37-18-25-14-30-39-24(11-13-43(30)2)17-38(49-8)41(50-9)40(39)28(25)21-35(37)47-6/h16-22,29-30H,10-15H2,1-9H3/t29-,30-/m0/s1
InChI key:InChIKey=ZCTJIMXXSXQXRI-KYJUHHDHSA-N
SMILES:O(C)C1=C2C=3[C@](CC=4C2=CC(OC)=C(OC5=C(C[C@H]6C=7C(=CC(OC)=C(OC)C7)CCN6C)C=C(OC)C(OC)=C5)C4)(N(C)CCC3C=C1OC)[H]
Synonyms:- (6aS)-9-[4,5-Dimethoxy-2-[[(1S)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]methyl]phenoxy]-5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-4H-dibenzo[de,g]quinoline
- 6aα-Aporphine, 9-[[4,5-dimethoxy-α-((S)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolyl)-o-tolyl]oxy]-1,2,10-trimethoxy-
- Thalicarpine
- 4H-Dibenzo[de,g]quinoline, 9-[4,5-dimethoxy-2-[[(1S)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]methyl]phenoxy]-5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, (6aS)-
- 4H-Dibenzo[de,g]quinoline, 9-[4,5-dimethoxy-2-[(1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl)methyl]phenoxy]-5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, [S-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thalicarpine
CAS:Thalicarpine, a natural anticancer alkaloid, inhibits p-glycoprotein and induces DNA damage, arresting cell cycle.Formula:C41H48N2O8Color and Shape:SolidMolecular weight:696.83
