CAS 53730-99-7
:2-iodobenzene-1-sulfonamide
Description:
2-Iodobenzene-1-sulfonamide, also known as iodoaniline sulfonamide, is an organic compound characterized by the presence of both an iodine atom and a sulfonamide functional group attached to a benzene ring. This compound typically appears as a solid and is soluble in polar solvents, such as water and alcohols, due to the sulfonamide group, which can engage in hydrogen bonding. The presence of the iodine atom introduces unique reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions. The sulfonamide group contributes to its potential biological activity, as many sulfonamides are known for their antibacterial properties. Additionally, 2-iodobenzene-1-sulfonamide can serve as a precursor in the synthesis of more complex organic molecules and is utilized in medicinal chemistry and material science. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C6H6INO2S
InChI:InChI=1/C6H6INO2S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,(H2,8,9,10)
SMILES:c1ccc(c(c1)I)S(=O)(=O)N
Synonyms:- 2-Iodobenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Iodobenzene-1-sulfonamide
CAS:<p>2-Iodobenzene-1-sulfonamide is a benzothiazine derivative that has been synthesized and its characteristics have been studied by molecular modeling. It has shown potential as an anti-inflammatory drug candidate. The pharmacophore of 2-iodobenzene-1-sulfonamide is composed of two amines, terminal alkynes, and a ligand. This molecule also showed activity against Cox-1 and Cox-2 enzymes, which are responsible for the production of prostaglandins and thromboxanes in the body. This study revealed that 2IBS is an efficient method to inhibit COX enzymes.</p>Formula:C6H6INO2SPurity:Min. 95%Molecular weight:283.09 g/mol
