CAS 53734-75-1

1,3-Benzenediol, 4-(5-methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b:5,4-b′]dipyran-3-yl)-

Description:

1,3-Benzenediol, 4-(5-methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b:5,4-b′]dipyran-3-yl)-, also known by its CAS number 53734-75-1, is a complex organic compound characterized by its unique structural features. This substance contains a benzene ring with hydroxyl groups, which contribute to its potential as a phenolic compound, influencing its reactivity and solubility in various solvents. The presence of a methoxy group enhances its lipophilicity, while the benzo[1,2-b:5,4-b′]dipyran moiety introduces additional aromaticity and potential for biological activity. Such compounds often exhibit interesting pharmacological properties, including antioxidant and anti-inflammatory effects, making them of interest in medicinal chemistry. The intricate structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, and materials science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various scientific domains.

Formula: C₂₁H₂₀O₅

InChI: InChI=1S/C21H20O5/c1-21(2)7-6-15-19(26-21)10-18-16(20(15)24-3)8-12(11-25-18)14-5-4-13(22)9-17(14)23/h4-10,22-23H,11H2,1-3H3

InChI key: InChIKey=LDZFETFUTCHVSH-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC3=C1C=CC(C)(C)O3)OCC(=C2)C4=C(O)C=C(O)C=C4

Synonyms:

• 2H,8H-Benzo[1,2-b:5,4-b′]dipyran, 1,3-benzenediol deriv.
• Neorauflavene
• 1,3-Benzenediol, 4-(5-methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b:5,4-b′]dipyran-3-yl)-

4-(5-Methoxy-8,8-dimethyl-2H,8H-benzo[1,2-b

CAS: 53734-75-1

Formula: C₂₁H₂₀O₅

Molecular weight: 352.3805

Ref: IN-DA00DGZL

Neorauflavene

CAS: 53734-75-1

Neorauflavene is a natural product of Fissistigma, Annonaceae.

Formula: C₂₁H₂₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 352.38

Ref: TM-TN4643

Neorauflavene

CAS: 53734-75-1

Formula: C₂₁H₂₀O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 352.386

Ref: BP-SBP02679

Neorauflavene

CAS: 53734-75-1

Neorauflavene is a flavonoid derivative, which is a compound type that exists within a class of polyphenolic plant secondary metabolites. Derived from natural sources, it is related to a class of biosynthetically produced plant-based compounds. Neorauflavene operates through modulation of inflammatory pathways, specifically by targeting and inhibiting specific enzymes and signaling molecules involved in inflammation.

Formula: C₂₁H₂₀O₅

Purity: Min. 95%

Molecular weight: 352.4 g/mol

Ref: 3D-DCA73475