CAS 53735-98-1
:1,2:5,6-Di-O-isopropylidene-D-glucitol
Description:
1,2:5,6-Di-O-isopropylidene-D-glucitol, with the CAS number 53735-98-1, is a carbohydrate derivative that serves as a protective agent for hydroxyl groups in sugar molecules. This compound features two isopropylidene groups, which enhance its stability and solubility in organic solvents. It is typically used in organic synthesis and carbohydrate chemistry, particularly in the protection and deprotection of hydroxyl functionalities during various chemical reactions. The presence of isopropylidene groups allows for selective reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, this compound is characterized by its relatively low toxicity and is generally handled with standard laboratory precautions. Its structural features contribute to its unique reactivity and utility in synthetic organic chemistry, particularly in the preparation of glycosides and other carbohydrate derivatives. Overall, 1,2:5,6-Di-O-isopropylidene-D-glucitol is an important compound in the field of carbohydrate chemistry, facilitating the manipulation of sugar structures for various applications.
Formula:C12H22O6
InChI:InChI=1/C12H22O6/c1-11(2)15-5-7(17-11)9(13)10(14)8-6-16-12(3,4)18-8/h7-10,13-14H,5-6H2,1-4H3
InChI key:InChIKey=ODYBCPSCYHAGHA-UTINFBMNSA-N
SMILES:[C@@H]([C@H](O)[C@@]1(OC(C)(C)OC1)[H])(O)[C@]2(OC(C)(C)OC2)[H]
Synonyms:- 1,2:5,6-Bis-O-(1-methylethylidene)-D-glucitol
- 1,2:5,6-Di-O-isopropylidene-D-glucitol
- D-Glucitol, 1,2:5,6-bis-O-(1-methylethylidene)-
- 1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)ethane-1,2-diol (non-preferred name)
- Einecs 258-736-5
- 1-O,2-O:5-O,6-O-Bis(1-methylethylidene)-D-glucitol
- 1-O,2-O:5-O,6-O-Diisopropylidene-D-glucitol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
