CAS 53749-89-6
:bis(2,2,2-trifluoroethyl) sulfite
Description:
Bis(2,2,2-trifluoroethyl) sulfite is a chemical compound characterized by its unique structure, which includes two trifluoroethyl groups attached to a sulfite functional group. This compound is notable for its high fluorine content, which imparts distinct physical and chemical properties, such as low surface tension and high thermal stability. It is typically a colorless liquid at room temperature and exhibits a relatively low boiling point compared to other sulfite esters. The presence of trifluoroethyl groups enhances its solubility in organic solvents while making it less polar. Bis(2,2,2-trifluoroethyl) sulfite is used in various applications, including as a reagent in organic synthesis and in the production of fluorinated compounds. Additionally, due to its fluorinated nature, it may exhibit low reactivity with many nucleophiles, making it a useful intermediate in chemical reactions. However, safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H4F6O3S
InChI:InChI=1/C4H4F6O3S/c5-3(6,7)1-12-14(11)13-2-4(8,9)10/h1-2H2
SMILES:C(C(F)(F)F)OS(=O)OCC(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bis(2,2,2-trifluoroethyl) sulfite
CAS:Bis(2,2,2-trifluoroethyl) sulfite
Molecular weight:246.12818g/molBis(2,2,2-trifluoroethyl) sulfite
CAS:Bis(2,2,2-trifluoroethyl) sulfite is an additive that enhances the performance of water-based inks and coatings. It is a colorless liquid with a low viscosity and high volatility. Bis(2,2,2-trifluoroethyl) sulfite is used as an additive to increase the solubility of other additives in water-based ink and coatings formulations. It has been shown to enhance the performance of these formulations by improving wetting properties. This additive also has been shown to reduce surface tension and improve gloss. The mechanism of action for this compound is not well understood but may be due to its ability to form hydrogen bonds and/or ionic interactions with molecules on the substrate surface.Formula:C4H4F6O3SPurity:Min. 95%Molecular weight:246.13 g/mol


