CAS 5375-49-5
:5,6-dihydroxy-5,6-dihydronaphthalen-1-yl methylcarbamate
Description:
5,6-Dihydroxy-5,6-dihydronaphthalen-1-yl methylcarbamate, with the CAS number 5375-49-5, is a chemical compound that belongs to the class of carbamates. This substance features a naphthalene core that is substituted with two hydroxyl groups at the 5 and 6 positions, contributing to its potential reactivity and solubility in polar solvents. The methylcarbamate functional group enhances its biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. The presence of hydroxyl groups can also influence its hydrogen bonding capabilities, affecting its interactions with biological systems. This compound may exhibit properties such as moderate to high stability under standard conditions, but its reactivity can vary based on environmental factors. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, 5,6-dihydroxy-5,6-dihydronaphthalen-1-yl methylcarbamate is a structurally interesting compound with potential applications in research and industry.
Formula:C12H13NO4
InChI:InChI=1/C12H13NO4/c1-13-12(16)17-10-4-2-3-8-7(10)5-6-9(14)11(8)15/h2-6,9,11,14-15H,1H3,(H,13,16)
SMILES:CN=C(O)Oc1cccc2c1C=CC(C2O)O
Synonyms:- 1,2,5-Naphthalenetriol, 1,2-Dihydro-, 5-(Methylcarbamate)
- 5375-49-5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Dihydrodihydroxycarbaryl
CAS:Controlled ProductFormula:C12H13NO4Color and Shape:NeatMolecular weight:235.24
