CAS 5378-27-8

4-(1,3,4-oxadiazol-2(3H)-ylidene)cyclohexa-2,5-dien-1-one

Description:

4-(1,3,4-Oxadiazol-2(3H)-ylidene)cyclohexa-2,5-dien-1-one, with the CAS number 5378-27-8, is a heterocyclic compound featuring a cyclohexadiene core substituted with an oxadiazole moiety. This compound exhibits notable characteristics such as a conjugated system that contributes to its potential as a chromophore, which may impart interesting optical properties. The presence of the oxadiazole ring enhances its stability and can influence its reactivity, making it a candidate for various applications in organic synthesis and materials science. Additionally, the compound may exhibit biological activity, which is common among oxadiazole derivatives, potentially leading to uses in pharmaceuticals or agrochemicals. Its structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electron-rich nature of the cyclohexadiene system. Overall, this compound represents a unique intersection of organic chemistry and materials science, with implications for further research and application development.

Formula: C₈H₆N₂O₂

InChI: InChI=1/C8H6N2O2/c11-7-3-1-6(2-4-7)8-10-9-5-12-8/h1-5,11H

SMILES: C1=CC(=O)C=CC1=c1[nH]nco1

Synonyms:

• 4-[1,3,4]Oxadiazol-2-yl-phenol
• phenol, 4-(1,3,4-oxadiazol-2-yl)-

4-(1,3,4-OXADIAZOL-2-YL)PHENOL

CAS: 5378-27-8

Formula: C₈H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA00DD02

4-(1,3,4-Oxadiazol-2-yl)phenol

CAS: 5378-27-8

4-(1,3,4-Oxadiazol-2-yl)phenol

Purity: 95%

Molecular weight: 162.15g/mol

Ref: 54-OR965587

4-(1,3,4-Oxadiazol-2-yl)phenol

Controlled Product

CAS: 5378-27-8

Applications 4-(1,3,4-Oxadiazol-2-yl)phenol is an intermediate in the synthesis of potential class II human histone deacetylase inhibitors.
References Flipo, M., et al.: J. Med. Chem., 55, 6391 (2012);

Formula: C₈H₆N₂O₂

Color and Shape: Neat

Molecular weight: 162.15

Ref: TR-O846570

4-(1,3,4-oxadiazol-2-yl)phenol

CAS: 5378-27-8

Formula: C₈H₆N₂O₂

Purity: 95.0%

Color and Shape: Yellow powder

Molecular weight: 162.148

Ref: 10-F311707

4-(1,3,4-Oxadiazol-2-yl)phenol

CAS: 5378-27-8

4-(1,3,4-Oxadiazol-2-yl)phenol (ODOP) is a potent and selective apoptosis inducer that causes the death of cancer cells by generating reactive oxygen species. ODOP activates polyphosphoric acid in the mitochondria to form reactive oxygen species. The cytotoxicity of ODOP is dose-dependent and can be reconfirmed by nucleophilic attack on DNA. ODOP has been shown to have pharmacokinetic properties that are similar to those of other drugs in the same class, such as acylhydrazides. These drugs are rapidly metabolized by esterases or glucuronidases in vivo and are excreted mainly through urine.

Formula: C₈H₆N₂O₂

Purity: Min. 95%

Molecular weight: 162.15 g/mol

Ref: 3D-FAA37827