CymitQuimica logo

CAS 53783-87-2

:

bicyclo[2.2.1]hept-2-en-7-ol

Description:
Bicyclo[2.2.1]hept-2-en-7-ol, with the CAS number 53783-87-2, is a bicyclic organic compound characterized by its unique structure, which consists of a bicycloheptene framework with a hydroxyl group (-OH) at the 7-position and a double bond at the 2-position. This compound exhibits a combination of rigidity and reactivity due to its bicyclic nature, making it an interesting subject for synthetic organic chemistry. The presence of the hydroxyl group contributes to its potential as an alcohol, influencing its solubility in polar solvents and its reactivity in various chemical reactions, such as dehydration and oxidation. Bicyclo[2.2.1]hept-2-en-7-ol can also participate in cycloaddition reactions and may serve as a precursor for the synthesis of more complex organic molecules. Its unique structural features may impart specific physical properties, such as boiling and melting points, which are influenced by intermolecular forces like hydrogen bonding. Overall, this compound is of interest in both academic research and potential applications in organic synthesis.
Formula:C7H10O
InChI:InChI=1/C7H10O/c8-7-5-1-2-6(7)4-3-5/h1-2,5-8H,3-4H2
Synonyms:
  • BICYCLO(2.2.1)HEPT-2-EN-7-OL
  • Bicyclo[2.2.1]hept-2-en-7-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.