CAS 53784-84-2
:6A,6B,6C,6D,6E,6F,6G,6H-Octabromo-6A,6B,6C,6D,6E,6F,6G,6H-octadeoxy-γ-cyclodextrin
Description:
6A,6B,6C,6D,6E,6F,6G,6H-Octabromo-6A,6B,6C,6D,6E,6F,6G,6H-octadeoxy-γ-cyclodextrin is a modified form of γ-cyclodextrin, a cyclic oligosaccharide composed of glucose units. This compound is characterized by the substitution of bromine atoms at specific positions on the cyclodextrin structure, which enhances its hydrophobic properties and alters its solubility profile. The presence of multiple bromine atoms contributes to its potential applications in various fields, including pharmaceuticals, where it may serve as a drug delivery system or in the encapsulation of hydrophobic compounds. Additionally, the octadeoxy modification indicates that the hydroxyl groups of the cyclodextrin have been replaced with hydrophobic chains, further influencing its interaction with other molecules. The unique structural features of this compound allow it to form inclusion complexes, making it valuable in enhancing the bioavailability of poorly soluble drugs. Its chemical stability and ability to interact with a variety of substances make it a subject of interest in material science and nanotechnology.
Formula:C48H72Br8O32
InChI:InChI=1S/C48H72Br8O32/c49-1-9-33-17(57)25(65)41(73-9)82-34-10(2-50)75-43(27(67)19(34)59)84-36-12(4-52)77-45(29(69)21(36)61)86-38-14(6-54)79-47(31(71)23(38)63)88-40-16(8-56)80-48(32(72)24(40)64)87-39-15(7-55)78-46(30(70)22(39)62)85-37-13(5-53)76-44(28(68)20(37)60)83-35-11(3-51)74-42(81-33)26(66)18(35)58/h9-48,57-72H,1-8H2/t9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32?,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-/m1/s1
InChI key:InChIKey=ONWAJCGYJSVQSX-NXDQAORESA-N
SMILES:C(Br)[C@@H]1[C@@]2([C@H](O)[C@@H](O)[C@](O1)(O[C@@]3([C@@H](CBr)O[C@@](C(O)[C@H]3O)(O[C@@]4([C@@H](CBr)O[C@@]([C@H](O)[C@H]4O)(O[C@@]5([C@@H](CBr)O[C@@]([C@H](O)[C@H]5O)(O[C@]6([C@H](O)[C@@H](O)[C@@](O[C@]7([C@H](O)[C@@H](O)[C@@](O[C@]8([C@H](O)[C@@H](O)[C@@](O[C@]9([C@H](O)[C@@H](O)[C@@](O2)(O[C@@H]9CBr)[H])[H])(O[C@@H]8CBr)[H])[H])(O[C@@H]7CBr)[H])[H])(O[C@@H]6CBr)[H])[H])[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- γ-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G,6H-octabromo-6A,6B,6C,6D,6E,6F,6G,6H-octadeoxy-
- 6A,6B,6C,6D,6E,6F,6G,6H-Octabromo-6A,6B,6C,6D,6E,6F,6G,6H-octadeoxy-γ-cyclodextrin
- Octakis-(6-bromo-6-deoxy)-γ-cyclodextrin
- 6-Bromo-6-deoxy-γ-cyclodextrin
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-Hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane, γ-cyclodextrin deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Bromo-6-deoxy-γ-cyclodextrin (octakis-(6-bromo-6-deoxy)-γ-cyclodextrin)
CAS:Heterocyclic compounds with oxygen hetero-atom(s) only, nesoiFormula:C48H72Br8O32Color and Shape:Off-White SolidMolecular weight:1791.74737OCTAKIS-6-BROMO-6-DEOXY-γ-CYCLODEXTRIN
CAS:Formula:C48H72Br8O32Purity:98%Color and Shape:SolidMolecular weight:1800.2981Sugammadex Impurity 3
CAS:Formula:C48H72Br8O32Color and Shape:Pale Gray SolidMolecular weight:1800.30Octakis-(6-bromo-6-deoxy)-γ-cyclodextrin-d24
CAS:Controlled ProductApplications Octakis-(6-bromo-6-deoxy)-γ-cyclodextrin-d24 is an intermediate in synthesizing Sugammadex Sodium-deuterated (S698102), which is the first in a class of drugs called selective relaxant binding agents that offers improved termination of the paralytic effects of neuromuscular blocking agents and may have many potential peri-operative benefits.
References Welliver, M., et al.: Drug Des. Devel. Ther., 2, 49 (2008)Formula:C48D24H48Br8O32Color and Shape:NeatMolecular weight:1824.4466-bromo-6-deoxy-gamma-cyclodextrin
CAS:This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.Formula:C48H72Br8O32Purity:Min. 95%Molecular weight:1,800.3 g/mol






