CAS 53786-44-0
:Ethyl 4-[(4-chloro-2-nitrophenyl)amino]-1-piperidinecarboxylate
Description:
Ethyl 4-[(4-chloro-2-nitrophenyl)amino]-1-piperidinecarboxylate, identified by its CAS number 53786-44-0, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of an ethyl ester functional group and a substituted aniline moiety, specifically a 4-chloro-2-nitrophenyl group. The nitro group introduces significant polarity and can influence the compound's reactivity and solubility. The presence of the chloro substituent also affects the electronic properties of the aromatic ring, potentially enhancing its biological activity. Ethyl 4-[(4-chloro-2-nitrophenyl)amino]-1-piperidinecarboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the synthesis of compounds targeting specific biological pathways. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C14H18ClN3O4
InChI:InChI=1S/C14H18ClN3O4/c1-2-22-14(19)17-7-5-11(6-8-17)16-12-4-3-10(15)9-13(12)18(20)21/h3-4,9,11,16H,2,5-8H2,1H3
InChI key:InChIKey=GMDPPHXPURQLKC-UHFFFAOYSA-N
SMILES:N(C1=C(N(=O)=O)C=C(Cl)C=C1)C2CCN(C(OCC)=O)CC2
Synonyms:- Ethyl 4-[(4-chloro-2-nitrophenyl)amino]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[(4-chloro-2-nitrophenyl)amino]-, ethyl ester
- Ethyl 4-((4-chloro-2-nitrophenyl)amino)piperidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

