CAS 538-81-8
:trans,trans-1,4-Diphenyl-1,3-butadiene
Description:
Trans,trans-1,4-Diphenyl-1,3-butadiene is an organic compound characterized by its conjugated diene structure, featuring two phenyl groups attached to a butadiene backbone. This compound is notable for its geometric configuration, specifically the trans arrangement of the double bonds, which contributes to its stability and unique optical properties. It typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone. The presence of the phenyl groups enhances its electron delocalization, making it a subject of interest in materials science and organic electronics, particularly in the development of organic light-emitting diodes (OLEDs) and photovoltaic devices. Additionally, trans,trans-1,4-Diphenyl-1,3-butadiene exhibits interesting photophysical properties, including fluorescence, which can be influenced by its environment and molecular interactions. Safety data indicates that, while it should be handled with care due to potential irritant properties, it is not classified as highly hazardous. Overall, its unique structural and electronic characteristics make it a valuable compound in various chemical research applications.
Formula:C16H14
InChI:InChI=1/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+
Synonyms:- (1,4-Diphenyl)-1,3-Butadiene
- 1,1'-Buta-1,3-diene-1,4-diyldibenzene
- 1,4-Diphenyl-trans-1,trans-3-butadiene
- Benzene, 1,1'-(1,3-Butadiene-1,4-Diyl)Bis-
- 1,1'-(1E,3E)-buta-1,3-diene-1,4-diyldibenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans,trans-1,4-Diphenyl-1,3-butadiene, 98+%
CAS:trans,trans-1,4-Diphenyl-1,3-butadiene reacts with Rieke metal complexes of barium and strontium to prepare metal-diene reagents, which is used for the carbocyclization with dichloroalkanes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. SomeFormula:C16H14Purity:98+%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:206.29trans,trans-1,4-Diphenyl-1,3-butadiene
CAS:Formula:C16H14Purity:97%Color and Shape:SolidMolecular weight:206.2824(1E,3E)-1,4-Diphenylbuta-1,3-diene
CAS:(1E,3E)-1,4-Diphenylbuta-1,3-dieneFormula:C16H14Purity:98%Color and Shape: white crystalline solidMolecular weight:206.28g/moltrans,trans-1,4-Diphenyl-1,3-butadiene
CAS:Used in the preparation of metal-diene reagents (e.g. for carbocyclization)
Formula:C16H14Purity:Min. 95%Molecular weight:206.28 g/mol




