CAS 5381-92-0
:1,3-diphenylpropan-2-ol
Description:
1,3-Diphenylpropan-2-ol, with the CAS number 5381-92-0, is an organic compound characterized by its structure, which features a propanol backbone substituted with two phenyl groups at the 1 and 3 positions. This compound typically appears as a white to off-white crystalline solid. It is known for its chiral center at the second carbon, leading to the existence of enantiomers. The compound is relatively soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic phenyl groups. 1,3-Diphenylpropan-2-ol exhibits properties typical of secondary alcohols, including the ability to undergo oxidation to form ketones and can participate in various chemical reactions, such as esterification and substitution. Its unique structure and properties make it of interest in organic synthesis and medicinal chemistry, where it may serve as a precursor or intermediate in the development of pharmaceuticals and other chemical products.
Formula:C15H16O
InChI:InChI=1/C15H16O/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2
SMILES:c1ccc(cc1)CC(Cc1ccccc1)O
Synonyms:- 1,3-Diphenyl-2-propanol
- Benzeneethanol, .alpha.-(phenylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,3-Diphenylpropan-2-ol
CAS:<p>1,3-Diphenylpropan-2-ol is an organic molecule that can be used in analytical toxicology. It has been shown to have a nonequivalence of 1,3-diphenylpropane and 2-hydroxypentane. The functional groups present on this molecule are the silicon atom and the organic acids. This molecule is metastable due to its radical coupling. 1,3-Diphenylpropan-2-ol is found in a number of chemical reactions including bond cleavage, aldehyde formation, alkene formation, and asymmetric synthesis. Cleavage products include 3-phenylpropanoic acid, phenylacetic acid, and phenylglycolic acid.</p>Formula:C15H16OPurity:Min. 95%Molecular weight:212.29 g/mol
