CAS 53818-11-4
:(3R,4R,5R,6R)-6-[2-chloro-4-[4-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazin-1-yl]phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3R,4R,5R,6R)-6-[2-chloro-4-[4-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazin-1-yl]phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "53818-11-4" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring with multiple hydroxyl groups, indicating potential solubility in polar solvents and biological activity. The presence of a piperazine moiety suggests possible interactions with biological targets, particularly in pharmacology. The chloro and triazole groups contribute to its reactivity and may enhance its binding affinity to specific receptors or enzymes. This compound is likely to exhibit significant biological properties, making it of interest in medicinal chemistry and drug development. Its structural complexity and stereochemical configuration may influence its pharmacokinetics and pharmacodynamics, which are critical for therapeutic applications. Overall, this substance represents a unique scaffold that could be explored for various biological activities.
Formula:C25H30ClN5O8
InChI:InChI=1/C25H30ClN5O8/c26-16-14-15(5-6-17(16)38-24-21(34)19(32)20(33)22(39-24)23(35)36)29-12-10-28(11-13-29)7-3-9-31-25(37)30-8-2-1-4-18(30)27-31/h1-2,4-6,8,14,19-22,24,32-34H,3,7,9-13H2,(H,35,36)/t19-,20-,21-,22?,24+/m1/s1
Synonyms:- 4-Hydroxytrazodone glucuronide
- 2-[3-[4-(m-Chloro-p-hydroxyphenyl)-1-piperazinyl]propyl]-s-triazolo[4,3-a]pyridin-3(2H)-one glucuronide
- 4'-Hydroxytrazodone b-D-glucuronide
- β-D-Glucopyranosiduronic acid, 2-chloro-4-[4-[3-(3-oxo-1,2,4-triazolo[4,3-a]pyridin-2(3H)-yl)propyl]-1-piperazinyl]phenyl
- 4’-Hydroxy Trazodone β-D-Glucuronide
- Trazodone Impurity 55
- Trazodone Impurity 50
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4'-Hydroxytrazodone b-D-glucuronide
CAS:<p>4'-Hydroxytrazodone b-D-glucuronide is a modification of the drug 4'-hydroxytrazodone, which is used to treat hypertension and depression. The modification prevents the degradation of 4'-hydroxytrazodone by glucuronyl transferase enzymes in the liver, prolonging its half-life. It is synthesized from the glycogen or starch of plants such as corn, wheat, or potatoes. This compound can also be found in natural sources such as honey and fruit juices.</p>Formula:C25H30ClN5O8Purity:Min. 95%Molecular weight:564 g/mol

