CAS 5382-30-9
:1-tert-butylpiperidin-4-ol
Description:
1-tert-Butylpiperidin-4-ol is an organic compound characterized by its piperidine ring structure, which features a tert-butyl group at the first position and a hydroxyl group at the fourth position. This compound is a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and pharmaceuticals. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. Additionally, the tert-butyl group enhances the steric bulk around the nitrogen atom, which can affect the compound's biological activity and pharmacokinetics. 1-tert-Butylpiperidin-4-ol is often studied for its potential use in drug development, particularly in the synthesis of compounds with neuroactive properties. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.
Formula:C9H19NO
InChI:InChI=1/C9H19NO/c1-9(2,3)10-6-4-8(11)5-7-10/h8,11H,4-7H2,1-3H3
SMILES:CC(C)(C)N1CCC(CC1)O
Synonyms:- 1-tert-Butyl-piperidin-4-ol
- 4-Piperidinol, 1-(1,1-Dimethylethyl)-
- 1-tert-Butylpiperidin-4-ol
- 1-(1,1-DiMethylethyl)-4-piperidinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-tert-Butyl-piperidin-4-ol
CAS:Formula:C9H19NOPurity:96%Color and Shape:SolidMolecular weight:157.25331-tert-Butylpiperidin-4-ol
CAS:Formula:C9H19NOPurity:96%Color and Shape:Liquid, OilMolecular weight:157.2571-tert-Butylpiperidin-4-ol
CAS:1-tert-Butylpiperidin-4-ol is a chemical compound that is used as a model drug. It is injected into the muscle to calibrate a signal and extract spatial information. The nitroxyl radical has been shown to have radical scavenging activity, and liposomal encapsulation of the drug may be an effective way to deliver it to cells in the body. 1-tert-Butylpiperidin-4-ol has been shown to have lipophilic properties, which would allow it to cross the blood brain barrier more easily than other drugs with hydrophilic properties.
Formula:C9H19NOPurity:Min. 95%Molecular weight:157.26 g/mol



