CAS 5382-47-8
:quinoline-6-carbohydrazide
Description:
Quinoline-6-carbohydrazide is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. It features a hydrazide functional group, which is indicative of its potential reactivity and biological activity. This compound typically appears as a crystalline solid and is soluble in various organic solvents. Quinoline derivatives are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of both the quinoline and hydrazide moieties suggests potential for biological activity, including antimicrobial and antitumor properties. Additionally, quinoline-6-carbohydrazide can participate in various chemical reactions, such as condensation and coupling reactions, making it valuable in synthetic chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, quinoline-6-carbohydrazide is a compound of interest in both research and industrial applications due to its unique structural features and potential utility.
Formula:C10H9N3O
InChI:InChI=1/C10H9N3O/c11-13-10(14)8-3-4-9-7(6-8)2-1-5-12-9/h1-6H,11H2,(H,13,14)
SMILES:c1cc2cc(ccc2nc1)C(=O)NN
Synonyms:- 6-Quinolinecarbohydrazide
- 6-Quinolinecarboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
