CAS 53823-02-2

4-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-2,3-dihydro-1H-inden-1-one

Description:

4-Hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-2,3-dihydro-1H-inden-1-one, with the CAS number 53823-02-2, is an organic compound characterized by its complex structure, which includes a hydroxyl group and a hydroxyethyl substituent. This compound features a tetramethyl-substituted indene core, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of solubility in organic solvents, depending on the specific conditions. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound exemplifies the diversity of organic chemistry and the potential for functionalization in synthetic pathways.

Formula: C₁₅H₂₀O₃

InChI: InChI=1/C15H20O3/c1-8-10(5-6-16)9(2)13(17)11-7-15(3,4)14(18)12(8)11/h16-17H,5-7H2,1-4H3

SMILES: Cc1c(CCO)c(C)c(c2CC(C)(C)C(=O)c12)O

Synonyms:

• 1H-inden-1-one, 2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-

Onitin

CAS: 53823-02-2

Formula: C₁₅H₂₀O₃

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 248.3175

Ref: IN-DA00DGZW

Onitin

CAS: 53823-02-2

Onitin shows super-oxide and DPPH free radical scavenging effects.It also exhibits hepatoprotective activity on tacrine-induced cytotoxicity in human liver-

Formula: C₁₅H₂₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.32

Ref: TM-TN4711

Onitin

CAS: 53823-02-2

Formula: C₁₅H₂₀O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 248.322

Ref: BP-SBP00726

Onitin

CAS: 53823-02-2

Onitin is a synthetic chemical compound classified as an enzyme inhibitor, which is derived from extensive laboratory synthesis processes involving advanced organic chemistry techniques. Its mode of action involves the targeted binding to specific active sites of enzymes, leading to the modulation or inhibition of the enzyme's activity. This action mechanism facilitates detailed study and understanding of enzyme functions and metabolic pathways.

Formula: C₁₅H₂₀O₃

Purity: Min. 95%

Molecular weight: 248.32 g/mol

Ref: 3D-DCA82302