CAS 53823-03-3
:4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one
Description:
4-Hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one, with the CAS number 53823-03-3, is a chemical compound characterized by its complex structure, which includes multiple hydroxyl groups and a dihydroindene framework. This compound typically exhibits properties associated with its functional groups, such as solubility in polar solvents due to the presence of hydroxyl groups. It may display biological activity, potentially serving as an intermediate in organic synthesis or as a precursor in the development of pharmaceuticals or agrochemicals. The presence of multiple methyl groups suggests that it may have hydrophobic characteristics, influencing its interaction with biological membranes. Additionally, the compound's structure may confer stability and reactivity under specific conditions, making it of interest in various chemical applications. Its synthesis and reactivity can be influenced by the steric and electronic effects of the substituents present on the indene core. Overall, this compound represents a unique blend of functional groups that can lead to diverse chemical behavior.
Formula:C15H20O4
InChI:InChI=1/C15H20O4/c1-8-10(4-5-16)9(2)13(18)11-6-15(3,7-17)14(19)12(8)11/h16-18H,4-7H2,1-3H3
SMILES:Cc1c(CCO)c(C)c(c2CC(C)(CO)C(=O)c12)O
Synonyms:- (-)-2,3-Dihydro-4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one
- 1H-Inden-1-one, 2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-, (-)-
- 4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one
- 1H-Inden-1-one,2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-,(2S)-
- 1H-Inden-1-one, 2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymet hyl)-2,5,7-trimethyl-, (-)-
- onitisin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Inden-1-one, 2,3-dihydro-4-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymet hyl)-2,5,7-trimethyl-, (-)-
CAS:Formula:C15H20O4Molecular weight:264.3169Onitisin
CAS:Onitisin, onitinoside and onitin can inhibit the contraction of isolated guinea-pig ileum.Formula:C15H20O4Purity:98%Color and Shape:SolidMolecular weight:264.32Onitisin
CAS:Onitisin is an antimicrobial agent, which is derived from microbial sources with the primary mode of action being the inhibition of bacterial cell wall synthesis. This compound is designed to disrupt the peptidoglycan layers essential for bacterial growth and survival, specifically targeting gram-positive bacteria. The bactericidal properties of Onitisin stem from its ability to bind to transpeptidase enzymes, crucial for cross-linking peptidoglycan chains, effectively halting bacterial proliferation.Formula:C15H20O4Purity:Min. 95%Molecular weight:264.32 g/mol




