CAS 53823-15-7
:3-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one
Description:
The chemical substance known as 3-[(2E,4E)-4,6-dimethylocta-2,4-dienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one, with the CAS number 53823-15-7, is a complex organic compound characterized by its pyridinone core structure, which features multiple functional groups. This compound contains a hydroxyl group at positions 1 and 4 of the pyridine ring, contributing to its potential reactivity and solubility in polar solvents. The presence of a conjugated diene system in the side chain enhances its chemical stability and may impart unique optical properties. Additionally, the para-hydroxyphenyl substituent suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. The overall structure indicates that it may exhibit antioxidant or anti-inflammatory properties, although specific biological activities would require further investigation. Its molecular complexity and functional diversity suggest potential applications in pharmaceuticals or agrochemicals, warranting further research into its synthesis and reactivity.
Formula:C21H23NO5
InChI:InChI=1/C21H23NO5/c1-4-13(2)11-14(3)5-10-18(24)19-20(25)17(12-22(27)21(19)26)15-6-8-16(23)9-7-15/h5-13,23,25,27H,4H2,1-3H3/b10-5+,14-11+
Synonyms:- 2(1H)-pyridinone, 3-[(2E,4E)-4,6-dimethyl-1-oxo-2,4-octadien-1-yl]-1,4-dihydroxy-5-(4-hydroxyphenyl)-
- 2(1H)-Pyridinone, 3-(4,6-dimethyl-1-oxo-2,4-octadienyl)-1,4-dihydroxy-5-(4-hydroxyphenyl)-, (E,E)-
- 3-[(2E,4E)-4,6-Dimethylocta-2,4-dienoyl]-1,4-dihydroxy-5-(4-hydroxyphenyl)pyridin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tenellin
CAS:Tenellin is a fungal metabolite that inhibits Mg2+-, Ca2+-, and Na+/K+-ATPase activities in erythrocytes. Tenellin is cytotoxic to Sf9 and Sf21 insect cells.Formula:C21H23NO5Color and Shape:SolidMolecular weight:369.41


