CAS 53826-01-0

2,8-dimethylquinoline hydrochloride

Description:

2,8-Dimethylquinoline hydrochloride is a chemical compound characterized by its structure, which includes a quinoline backbone with two methyl groups located at the 2 and 8 positions. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is a common trait for many hydrochloride salts. It exhibits basic properties due to the presence of the nitrogen atom in the quinoline ring, allowing it to form salts with acids, such as hydrochloric acid. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and applications. It may serve as an intermediate in the synthesis of pharmaceuticals or other organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,8-dimethylquinoline hydrochloride is a versatile compound with notable characteristics that make it valuable in chemical research and applications.

Formula: C₁₁H₁₂ClN

InChI: InChI=1/C11H11N.ClH/c1-8-4-3-5-10-7-6-9(2)12-11(8)10;/h3-7H,1-2H3;1H

SMILES: Cc1cccc2ccc(C)nc12.Cl

2,8-Dimethylquinoline hydrochloride

CAS: 53826-01-0

2,8-Dimethylquinoline hydrochloride

Purity: ≥95%

Molecular weight: 193.67g/mol

Ref: 54-OR307890