CAS 53833-85-5
:(1S,3R,5S)-4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hex-3-yl acetate
Description:
The chemical substance known as (1S,3R,5S)-4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hex-3-yl acetate, with the CAS number 53833-85-5, is a bicyclic compound characterized by its unique structural framework. This compound features a bicyclo[3.1.0]hexane core, which is a fused ring system that contributes to its rigidity and specific stereochemistry. The presence of a methylidene group and an isopropyl substituent enhances its reactivity and potential applications in organic synthesis. Additionally, the acetate functional group indicates that it can undergo hydrolysis or transesterification reactions, making it versatile in various chemical processes. The stereochemistry, denoted by the (1S,3R,5S) configuration, suggests that the compound exhibits chirality, which may influence its biological activity and interactions with other molecules. Overall, this compound's structural features and functional groups position it as an interesting candidate for further study in fields such as medicinal chemistry and materials science.
Formula:C12H18O2
InChI:InChI=1/C12H18O2/c1-7(2)12-5-10(12)8(3)11(6-12)14-9(4)13/h7,10-11H,3,5-6H2,1-2,4H3/t10-,11-,12+/m1/s1
Synonyms:- (1alpha,3beta,5alpha)-4-Methylene-1-(1-methylethyl)bicyclo(3.1.0)hexan-3-ol acetate
- (1S,3R,5S)-1-Isopropyl-4-methylenbicyclo[3.1.0]hex-3-ylacetat
- (1S,3R,5S)-1-Isopropyl-4-methylenebicyclo[3.1.0]hex-3-yl acetate
- 53833-85-5
- Bicyclo(3.1.0)hexan-3-ol, 4-methylene-1-(1-methylethyl)-, acetate, (1alpha,3beta,5alpha)-
- bicyclo[3.1.0]hexan-3-ol, 4-methylene-1-(1-methylethyl)-, acetate, (1S,3R,5S)-
- cis-Sabinyl acetate
- (Z)-sabinyl acetate
- Sabinylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Sabinyl acetate
CAS:Acetic acid esterFormula:C12H18O2Purity:≥ 90.0 % (GC)Color and Shape:OilMolecular weight:194.27Sabinyl acetate
CAS:Sabinyl acetate is a naturally occurring organic compound, which is an ester derived from the terpene sabinene. It is primarily sourced from essential oils of certain coniferous trees, such as those in the Juniperus species. The compound exhibits a mode of action that involves binding to olfactory receptors, making it an effective fragrance agent. Additionally, it demonstrates antimicrobial properties by disrupting microbial cell membranes, leading to cell death.Formula:C12H18O2Purity:Min. 95%Molecular weight:194.27 g/mol

