CAS 53834-55-2
:(2S,3R,4S,5R)-3,4,5-trihydroxy-6-oxopiperidine-2-carboxylic acid
Description:
The chemical substance known as (2S,3R,4S,5R)-3,4,5-trihydroxy-6-oxopiperidine-2-carboxylic acid, with the CAS number 53834-55-2, is a naturally occurring compound that belongs to the class of piperidine derivatives. This compound features a piperidine ring with multiple hydroxyl groups at the 3, 4, and 5 positions, contributing to its hydrophilicity and potential for forming hydrogen bonds. The presence of a carboxylic acid group at the 2-position and a keto group at the 6-position enhances its reactivity and solubility in polar solvents. Its stereochemistry, indicated by the (2S,3R,4S,5R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with enzymes or receptors. This compound may play a role in various biochemical pathways and could be of interest in medicinal chemistry for its potential therapeutic applications. Overall, its unique structural features make it a subject of interest for further research in both synthetic and natural product chemistry.
Formula:C6H9NO6
InChI:InChI=1/C6H9NO6/c8-2-1(6(12)13)7-5(11)4(10)3(2)9/h1-4,8-10H,(H,7,11)(H,12,13)/t1-,2+,3-,4+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Glucaro-1,5-lactam potassium salt
CAS:<p>D-Glucaro-1,5-lactam potassium salt is a synthetic compound that can be used as a building block for the synthesis of glycosylated carbohydrates. It is fluorinated to prevent hydrolysis and methylated to protect against oxidation. This product is also suitable for click modification, polysaccharide synthesis, and glycosylation reactions. D-Glucaro-1,5-lactam potassium salt has CAS No. 53834-55-2 and can be custom synthesized in high purity.</p>Formula:C6H9NO6·xKPurity:Min. 95%Color and Shape:PowderMolecular weight:191.14 g/mol
