CAS 538342-98-2
:1-(4-Propylphenyl)methanamine
Description:
1-(4-Propylphenyl)methanamine, with the CAS number 538342-98-2, is an organic compound characterized by its amine functional group and a propyl-substituted phenyl ring. This compound features a methanamine backbone, where a propyl group is attached to the para position of the phenyl ring, influencing its physical and chemical properties. Typically, such compounds exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the propyl group. The presence of the amine group suggests potential basicity and reactivity, allowing for interactions such as hydrogen bonding and nucleophilic substitution. Additionally, 1-(4-Propylphenyl)methanamine may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, this compound exemplifies the diverse chemistry associated with substituted amines.
Formula:C10H15N
InChI:InChI=1/C10H15N/c1-2-3-9-4-6-10(8-11)7-5-9/h4-7H,2-3,8,11H2,1H3
SMILES:CCCc1ccc(cc1)CN
Synonyms:- 4-Propylbenzenemethanamine
- 4-Propylbenzylamine
- Benzenemethanamine, 4-propyl-
- Z1R D3
- 4-N-Propylbenzylamine
- 4-N-propylbenzyl amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Propylbenzylamine
CAS:<p>4-Propylbenzylamine is a chemical compound that is an intermediate for the synthesis of other chemicals. It is a versatile building block that can be used in research to create useful scaffolds or as a reaction component to form complex compounds. 4-Propylbenzylamine has been shown to have high purity, and it is soluble in most solvents. The CAS number for this chemical is 538342-98-2.</p>Formula:C10H15NPurity:Min. 95%Color and Shape:PowderMolecular weight:149.23 g/mol
