CAS 53843-92-8

glycylleucylglycylleucine

Description:

Glycylleucylglycylleucine, with the CAS number 53843-92-8, is a synthetic dipeptide composed of the amino acids glycine and leucine. This compound is characterized by its peptide bonds linking the amino acids in a specific sequence, which influences its biochemical properties and potential biological activity. Glycylleucylglycylleucine is typically soluble in water due to the presence of polar amino acid side chains, which can interact favorably with water molecules. It may exhibit properties such as being a substrate for various enzymes or having potential roles in cellular signaling or metabolism. The compound's structure allows it to participate in various biochemical pathways, making it of interest in research related to peptide synthesis, drug development, and understanding protein interactions. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and potential therapeutic applications.

Formula: C₁₆H₃₀N₄O₅

InChI: InChI=1/C16H30N4O5/c1-9(2)5-11(19-13(21)7-17)15(23)18-8-14(22)20-12(16(24)25)6-10(3)4/h9-12H,5-8,17H2,1-4H3,(H,18,23)(H,19,21)(H,20,22)(H,24,25)

SMILES: CC(C)CC(C(=NCC(=NC(CC(C)C)C(=O)O)O)O)N=C(CN)O

Synonyms:

• Gly-Leu-Gly-Leu
• H-Gly-Leu-Gly-Leu-OH

H-Gly-Leu-Gly-Leu-OH

CAS: 53843-92-8

Formula: C₁₆H₃₀N₄O₅

Molecular weight: 358.4332

Ref: IN-DA00DCAV

H-Gly-Leu-Gly-Leu-OH

CAS: 53843-92-8

Please enquire for more information about H-Gly-Leu-Gly-Leu-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₃₀N₄O₅

Purity: Min. 95%

Molecular weight: 358.43 g/mol

Ref: 3D-FG109031