CymitQuimica logo

CAS 53843-93-9

:

glycylserylalanine

Description:
Glycylserylalanine, with the CAS number 53843-93-9, is a tripeptide composed of three amino acids: glycine, serine, and alanine. As a peptide, it exhibits characteristics typical of amino acid chains, including the ability to form hydrogen bonds and participate in various biochemical interactions. Glycylserylalanine is generally soluble in water due to the presence of polar side chains, particularly from serine, which contains a hydroxyl group. This tripeptide can play a role in biological processes, potentially influencing protein synthesis and cellular signaling pathways. Its structure allows for flexibility and conformational changes, which are essential for its biological function. Additionally, like other peptides, it may exhibit specific biological activities, such as acting as a signaling molecule or influencing metabolic pathways. The stability and reactivity of glycylserylalanine can be affected by factors such as pH and temperature, which are important considerations in both laboratory and physiological contexts.
Formula:C8H15N3O5
InChI:InChI=1/C8H15N3O5/c1-4(8(15)16)10-7(14)5(3-12)11-6(13)2-9/h4-5,12H,2-3,9H2,1H3,(H,10,14)(H,11,13)(H,15,16)
Synonyms:
  • H-Gly-Ser-Ala-Oh
  • alanine, glycylseryl-
  • Glycylserylalanine
  • glycyl-L-seryl-L-alanine
  • Gly-ser-ala
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.