CAS 53844-46-5

3-(3,4-dihydro-2H-pyrrol-2-yl)pyridine

Description:

3-(3,4-dihydro-2H-pyrrol-2-yl)pyridine, with the CAS number 53844-46-5, is an organic compound characterized by its pyridine and pyrrolidine moieties. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a dihydropyrrole group, which is a five-membered ring with one nitrogen atom that is partially saturated. The presence of these two structural elements contributes to its potential biological activity and makes it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the nitrogen atoms in its structure, which can engage in hydrogen bonding. Its unique structure may influence its reactivity and interaction with biological targets, making it a candidate for further research in pharmacology and drug development. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which can be exploited in various chemical applications.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5-7,9H,2,4H2

SMILES: c1cc(cnc1)C1CCC=N1

Isomyosmine

CAS: 53844-46-5

Isomyosmine

Purity: 98%

Ref: 54-OR1041461

Isomyosmine

CAS: 53844-46-5

Isomyosmine inhibits nitrate reductase and reduces oxidative stress. Isomyosmine is used to study inflammation and virus infection related to oxidoreductase.

Formula: C₉H₁₀N₂

Purity: 99.16%

Color and Shape: Soild

Molecular weight: 146.19

Ref: TM-T85324