CAS 53848-01-4

5-(3-Methoxyphenyl)-1H-imidazole

Description:

5-(3-Methoxyphenyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 3-methoxyphenyl group indicates that a methoxy-substituted phenyl group is attached to the imidazole, influencing its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic component. It is often studied for its potential biological activities, including antimicrobial and antifungal properties, owing to the imidazole moiety, which is common in many pharmacologically active compounds. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, its synthesis and characterization are of interest in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety data should be consulted when handling this substance in laboratory settings.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c1-13-9-4-2-3-8(5-9)10-6-11-7-12-10/h2-7H,1H3,(H,11,12)

InChI key: InChIKey=BGMJZDBEIHGNEJ-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1)C2=CN=CN2

Synonyms:

• 1H-Imidazole, 5-(3-methoxyphenyl)-
• 5-(3-Methoxyphenyl)-1H-imidazole
• 4-(3-Methoxyphenyl)-1H-imidazole
• 1H-Imidazole, 4-(3-methoxyphenyl)-

4-(3-Methoxyphenyl)-1H-imidazole

CAS: 53848-01-4

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-DCA84801