CAS 53857-58-2
:7-Bromo-1H-indazole
Description:
7-Bromo-1H-indazole is a heterocyclic organic compound characterized by its indazole structure, which consists of a fused benzene and pyrazole ring. The presence of a bromine atom at the 7-position of the indazole ring significantly influences its chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer effects, depending on the specific substituents and structural modifications. The compound is generally soluble in organic solvents, and its reactivity can be attributed to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, 7-Bromo-1H-indazole can serve as a useful intermediate in organic synthesis, allowing for the introduction of various functional groups. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c8-6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10)
InChI key:InChIKey=KMHHWCPTROQUFM-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1)C=NN2
Synonyms:- 1H-Indazole, 7-bromo-
- 7-Bromoindazole
- T56 Bmnj Ie
- 7-Bromo-1H-indazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA00DEHY
1g25.00€5g52.00€10g66.00€25g130.00€5kgTo inquire100g287.00€10kgTo inquire250gTo inquire500gTo inquire250mg21.00€7-Bromo-1H-indazole
CAS:<p>7-Bromo-1H-indazole</p>Formula:C7H5BrN2Purity:97%Color and Shape: off white solidMolecular weight:197.03g/mol7-Bromo-1H-indazole
CAS:<p>7-Bromo-1H-indazole is a brominated indazole with an unusual amino acid sequence. It can be used as a building block for the synthesis of new compounds that have potential as medicines. 7-Bromo-1H-indazole has been investigated in cancer cell lines, and it has been shown to inhibit the growth of these cells by inhibiting the production of chloride ions. The molecular modeling of this compound has also shown that it may bind to the chloride channel on cancer cells, preventing chloride ions from entering or leaving the cell. The X-ray crystal structures show that 7-bromoindazole binds with hydrogen bonds to azobisisobutyronitrile (AIBN) and ruthenium complex, which are both potential anticancer drugs.</p>Formula:C7H5BrN2Purity:Min. 95%Molecular weight:197.03 g/mol
