CAS 53857-60-6

2,4-dibromo-1-methyl-1H-imidazole

Description:

2,4-Dibromo-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring structure, which contains nitrogen atoms. This compound features two bromine substituents at the 2 and 4 positions and a methyl group at the 1 position of the imidazole ring. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the imidazole ring is known for its biological activity, often serving as a scaffold in drug design. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,4-dibromo-1-methyl-1H-imidazole is an important compound in organic chemistry with potential applications in multiple fields.

Formula: C₄H₄Br₂N₂

InChI: InChI=1/C4H4Br2N2/c1-8-2-3(5)7-4(8)6/h2H,1H3

SMILES: Cn1cc(Br)nc1Br

2,4-dibromo-1-methyl-1h-imidazole

CAS: 53857-60-6

Formula: C₄H₄Br₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.8960

Ref: IN-DA00DABW

2,4-Dibromo-1-methyl-1H-imidazole

CAS: 53857-60-6

2,4-Dibromo-1-methyl-1H-imidazole

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: beige solid

Molecular weight: 239.90g/mol

Ref: 54-OR1228

2,4-Dibromo-1-methyl-1H-imidazole

CAS: 53857-60-6

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.898

Ref: 10-F211699

2,4-Dibromo-1-methyl-1H-imidazole

CAS: 53857-60-6

Please enquire for more information about 2,4-Dibromo-1-methyl-1H-imidazole including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₄H₄Br₂N₂

Purity: Min. 95%

Molecular weight: 239.9 g/mol

Ref: 3D-FD155731