CAS 53861-57-7
:γ-Carboxyglutamic acid
Description:
γ-Carboxyglutamic acid, also known as Gla, is a non-proteinogenic amino acid characterized by the presence of an additional carboxyl group at the gamma position relative to the glutamic acid backbone. This unique structure imparts specific biochemical properties, particularly its ability to chelate calcium ions, which is crucial for its role in various physiological processes, including blood coagulation. Gla is predominantly found in certain proteins, such as prothrombin and other vitamin K-dependent proteins, where it plays a vital role in the regulation of blood clotting. The presence of the extra carboxyl group enhances the acidity of the molecule, influencing its solubility and reactivity in biological systems. γ-Carboxyglutamic acid is synthesized in the body through a post-translational modification of glutamic acid residues in the presence of vitamin K. Its significance extends beyond coagulation, as it is also involved in bone metabolism and the regulation of calcium homeostasis. Overall, γ-Carboxyglutamic acid is an essential component in various biological functions, highlighting its importance in health and disease.
Formula:C6H9NO6
InChI:InChI=1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1
InChI key:InChIKey=UHBYWPGGCSDKFX-VKHMYHEASA-N
SMILES:C(C[C@@H](C(O)=O)N)(C(O)=O)C(O)=O
Synonyms:- (1S)-1-Aminopropane-1,3,3-tricarboxylic acid
- (2S)-2-Azaniumyl-4-carboxy-5-hydroxy-5-oxopentanoate
- (3S)-3-Amino-1,1,3-propanetricarboxylic acid
- (3S)-3-aminopropane-1,1,3-tricarboxylic acid
- (S)-γ-Carboxyglutamic acid
- 1,1,3-Propanetricarboxylic acid 3-amino-, (3S)-
- 1,1,3-Propanetricarboxylic acid, 3-amino-, (S)-
- 4-Carboxyglutamic acid
- <span class="text-smallcaps">L</span>-γ-Carboxyglutamic acid
- H-.gamma.-Carboxy-Glu-OH
- H-Gla-Oh
- γ-Carboxy-<span class="text-smallcaps">L</span>-glutamic acid
- γ-Carboxyglutamic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-γ-Carboxy-Glu-OH
CAS:<p>Bachem ID: 4001771.</p>Formula:C6H9NO6Purity:> 99%Color and Shape:White PowderMolecular weight:191.14γ-Carboxy-L-glutamic acid
CAS:Formula:C6H9NO6Purity:≥ 98%Color and Shape:White powderMolecular weight:191.14H-γ-Carboxy-Glu-OH
CAS:<p>H-gamma-carboxy-Glu-OH is a synthetic peptide with the amino acid sequence H-gamma-Carboxy-Glu. It is a glp-1 analogue and its function is to regulate glucose homeostasis. The protein has been shown to have antiapoptotic effects in human osteosarcoma cells. H-gamma-carboxy-Glu-OH has also been shown to regulate mitochondrial membrane potential, which is required for cell signaling pathways and calcium binding. H-gamma-carboxy-Glu-OH's receptor molecule is known as the GPCR, which plays an important role in the regulation of cell signaling pathways and calcium binding. H gamma carboxy Glu OH is a cyclic peptide that contains disulfide bonds. This compound has the basic structure of an alpha helix, which consists of many turns of amino acids bonded together by hydrogen bonds between individual amino acids</p>Formula:C6H9NO6Purity:Min. 95%Color and Shape:PowderMolecular weight:191.14 g/mol



