CAS 53868-44-3
:(2-nitrophenyl)propanedial
Description:
(2-Nitrophenyl)propanedial, with the CAS number 53868-44-3, is an organic compound characterized by its structure, which includes a propanedial backbone substituted with a 2-nitrophenyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. It is likely to be a solid at room temperature and may have a moderate melting point. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or reductions. Additionally, (2-nitrophenyl)propanedial may participate in condensation reactions due to the aldehyde functional groups, making it a potential intermediate in organic synthesis. Its applications could extend to fields such as pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and functional properties. Safety data should be consulted for handling and storage, as nitro compounds can be hazardous.
Formula:C9H7NO4
InChI:InChI=1/C9H7NO4/c11-5-7(6-12)8-3-1-2-4-9(8)10(13)14/h1-7H
SMILES:c1ccc(c(c1)C(C=O)C=O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2-Nitrophenyl)malondialdehyde
CAS:Controlled ProductApplications 2-(2-Nitrophenyl)malondialdehyde (cas# 53868-44-3) is a useful research chemical.
Formula:C9H7NO4Color and Shape:NeatMolecular weight:193.156
