CymitQuimica logo

CAS 5388-21-6

:

2-(Methylamino)-5-pyrimidinecarboxylic acid

Description:
2-(Methylamino)-5-pyrimidinecarboxylic acid, also known by its CAS number 5388-21-6, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and a methylamino group, contributing to its polar nature and potential for hydrogen bonding. It is typically a white to off-white solid and is soluble in water due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a biochemical probe. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and purity of the sample. As with many pyrimidine derivatives, it may exhibit biological activity, making it a subject of research in drug development and related applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C6H7N3O2
InChI:InChI=1S/C6H7N3O2/c1-7-6-8-2-4(3-9-6)5(10)11/h2-3H,1H3,(H,10,11)(H,7,8,9)
InChI key:InChIKey=DWWXWTKPKXGUDC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=NC(NC)=NC1
Synonyms:
  • 2-(Methylamino)-5-pyrimidinecarboxylic acid
  • 5-Pyrimidinecarboxylic Acid, 2-(Methylamino)-
  • 2-(Methylamino)pyrimidine-5-carboxylic acid
Found 4 products.