CAS 53895-37-7
:Hexane, 1,6-diisocyanato-, dimer
Description:
Hexane, 1,6-diisocyanato-, dimer, with the CAS number 53895-37-7, is a chemical compound that belongs to the family of isocyanates. It is characterized by the presence of two isocyanate functional groups (-N=C=O) attached to a hexane backbone, which contributes to its reactivity and utility in various applications. This compound typically appears as a viscous liquid or solid, depending on temperature and specific formulation. It is primarily used in the production of polyurethane materials, serving as a hardener or crosslinking agent in coatings, adhesives, and elastomers. Due to the presence of isocyanate groups, it is highly reactive, particularly with moisture and amines, leading to the formation of urea linkages. Safety precautions are essential when handling this substance, as isocyanates can be hazardous, causing respiratory irritation and sensitization. Proper protective equipment and ventilation are recommended to mitigate exposure risks. Overall, Hexane, 1,6-diisocyanato-, dimer plays a significant role in the polymer industry, contributing to the development of durable and versatile materials.
Formula:(C8H12N2O2)2
InChI:InChI=1S/C8H12N2O2/c11-7-9-5-3-1-2-4-6-10-8-12/h1-6H2
InChI key:InChIKey=RRAMGCGOFNQTLD-UHFFFAOYSA-N
SMILES:C(CCCN=C=O)CCN=C=O
Synonyms:- HDI dimer
- Hexamethylene diisocyanate dimer
- Hexane, 1,6-diisocyanato-, dimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
