CymitQuimica logo

CAS 53899-17-5

:

8-methoxy-1,2,3,4-tetrahydroquinoline

Description:
8-Methoxy-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its bicyclic structure, which includes a quinoline core with a methoxy group attached at the 8-position. This compound is part of the tetrahydroquinoline family, indicating that it contains a saturated ring system, which contributes to its unique chemical properties. It typically exhibits moderate polarity due to the presence of the methoxy group, influencing its solubility in various organic solvents. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, 8-methoxy-1,2,3,4-tetrahydroquinoline can undergo various chemical reactions, including oxidation and substitution, which can be utilized in synthetic organic chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a versatile scaffold for further chemical exploration and development.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-12-9-6-2-4-8-5-3-7-11-10(8)9/h2,4,6,11H,3,5,7H2,1H3
InChI key:ZPRWUIXDTQZKJO-UHFFFAOYSA-N
SMILES:COc1cccc2CCCNc12
Synonyms:
  • Quinoline, 1,2,3,4-Tetrahydro-8-Methoxy-
Found 4 products.